C21H22N2O3 — CID 51267894
N-(3-methyl-4-pyrrolidin-1-ylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 51267894) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(3-methyl-4-pyrrolidin-1-ylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 51267894 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2Cc3ccccc3C(=O)O2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H22N2O3/c1-14-12-16(8-9-18(14)23-10-4-5-11-23)22-20(24)19-13-15-6-2-3-7-17(15)21(25)26-19/h2-3,6-9,12,19H,4-5,10-11,13H2,1H3,(H,22,24) |
| InChIKey | FZJUCLZYGWLGFW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|