C21H30N2O2 — CID 51271912
[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 51271912) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51271912 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)C2C(C=C(C)C)C2(C)C)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-15(2)14-16-19(21(16,3)4)20(24)23-12-10-22(11-13-23)17-8-6-7-9-18(17)25-5/h6-9,14,16,19H,10-13H2,1-5H3 |
| InChIKey | BOCOLHNUANKZDS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|