C21H28N2O3 — CID 52532257
[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone (PubChem CID 52532257) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 52532257 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[4-(2-hydroxybenzoyl)piperazin-1-yl]methanone |
| SMILES | CC(C)=C[C@H]1[C@H](C(=O)N2CCN(C(=O)c3ccccc3O)CC2)C1(C)C |
| InChI | InChI=1S/C21H28N2O3/c1-14(2)13-16-18(21(16,3)4)20(26)23-11-9-22(10-12-23)19(25)15-7-5-6-8-17(15)24/h5-8,13,16,18,24H,9-12H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | CWHMUZCUIQSSCY-FUHWJXTLSA-N |
| XLogP | 2.91 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|