C17H28N2O2 — CID 95567679
2-[1-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperidin-4-yl]acetamide (PubChem CID 95567679) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[1-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 95567679 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-[1-[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]piperidin-4-yl]acetamide |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)N2CCC(CC(N)=O)CC2)C1(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-11(2)9-13-15(17(13,3)4)16(21)19-7-5-12(6-8-19)10-14(18)20/h9,12-13,15H,5-8,10H2,1-4H3,(H2,18,20)/t13-,15-/m1/s1 |
| InChIKey | ICPFYYRJLGFCQJ-UKRRQHHQSA-N |
| XLogP | 2.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|