C20H22N2OS — CID 5127540
N-(16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl)-N-methylacetamide (PubChem CID 5127540) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is N-(16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl)-N-methylacetamide.
| Compound Name | N-(16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 5127540 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl)-N-methylacetamide |
| SMILES | CCC1CC(N(C)C(C)=O)c2cccc3c2N1c1ccccc1S3 |
| InChI | InChI=1S/C20H22N2OS/c1-4-14-12-17(21(3)13(2)23)15-8-7-11-19-20(15)22(14)16-9-5-6-10-18(16)24-19/h5-11,14,17H,4,12H2,1-3H3 |
| InChIKey | FLMRZASPRFCHOT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |