C19H21NOS — CID 10757439
(14R,16R)-14-ethoxy-16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene (PubChem CID 10757439) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is (14R,16R)-14-ethoxy-16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene.
| Compound Name | (14R,16R)-14-ethoxy-16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene |
|---|---|
| PubChem CID | 10757439 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (14R,16R)-14-ethoxy-16-ethyl-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene |
| SMILES | CCO[C@@H]1C[C@@H](CC)N2c3ccccc3Sc3cccc1c32 |
| InChI | InChI=1S/C19H21NOS/c1-3-13-12-16(21-4-2)14-8-7-11-18-19(14)20(13)15-9-5-6-10-17(15)22-18/h5-11,13,16H,3-4,12H2,1-2H3/t13-,16-/m1/s1 |
| InChIKey | PUICPYNPUNMHEP-CZUORRHYSA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |