C19H24FN3O4 — CID 51276378
1-cyclopentyl-N'-[2-(4-fluorophenoxy)propanoyl]-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 51276378) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-cyclopentyl-N'-[2-(4-fluorophenoxy)propanoyl]-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-cyclopentyl-N'-[2-(4-fluorophenoxy)propanoyl]-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 51276378 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-cyclopentyl-N'-[2-(4-fluorophenoxy)propanoyl]-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C19H24FN3O4/c1-12(27-16-8-6-14(20)7-9-16)18(25)21-22-19(26)13-10-17(24)23(11-13)15-4-2-3-5-15/h6-9,12-13,15H,2-5,10-11H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | XEKRUEOTKLSGFL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|