C21H22FN3O5 — CID 55559454
N'-[2-(4-fluorophenoxy)propanoyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 55559454) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)propanoyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenoxy)propanoyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55559454 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)propanoyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | COc1cccc(N2CC(C(=O)NNC(=O)C(C)Oc3ccc(F)cc3)CC2=O)c1 |
| InChI | InChI=1S/C21H22FN3O5/c1-13(30-17-8-6-15(22)7-9-17)20(27)23-24-21(28)14-10-19(26)25(12-14)16-4-3-5-18(11-16)29-2/h3-9,11,13-14H,10,12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | IQULVRALYANCNB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|