C16H20N2O4 — CID 51283472
2-(2-hydroxy-3-phenylmethoxypropyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 51283472) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phenylmethoxypropyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-(2-hydroxy-3-phenylmethoxypropyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 51283472 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(2-hydroxy-3-phenylmethoxypropyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1C2CCCN2C(=O)N1CC(O)COCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O4/c19-13(11-22-10-12-5-2-1-3-6-12)9-18-15(20)14-7-4-8-17(14)16(18)21/h1-3,5-6,13-14,19H,4,7-11H2 |
| InChIKey | XGUGTMWPAWUBFT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|