C17H30N2O4S — CID 512839
2-amino-3-(3-methyl-1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid (PubChem CID 512839) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is 2-amino-3-(3-methyl-1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid.
| Compound Name | 2-amino-3-(3-methyl-1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 512839 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-amino-3-(3-methyl-1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid |
| SMILES | CCCCCCCCCN1C(=O)CC(C)(SCC(N)C(=O)O)C1=O |
| InChI | InChI=1S/C17H30N2O4S/c1-3-4-5-6-7-8-9-10-19-14(20)11-17(2,16(19)23)24-12-13(18)15(21)22/h13H,3-12,18H2,1-2H3,(H,21,22) |
| InChIKey | HTGHPRKOXYTMNC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|