C21H21NO5 — CID 51286583
ethyl (E)-3-[4-[(2-methyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl)amino]phenyl]prop-2-enoate (PubChem CID 51286583) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(2-methyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl)amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(2-methyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 51286583 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl (E)-3-[4-[(2-methyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl)amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)C2Oc3ccccc3OC2C)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-3-25-19(23)13-10-15-8-11-16(12-9-15)22-21(24)20-14(2)26-17-6-4-5-7-18(17)27-20/h4-14,20H,3H2,1-2H3,(H,22,24)/b13-10+ |
| InChIKey | IURIDLHTYKIQKL-JLHYYAGUSA-N |
| XLogP | 3.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|