C17H24N2O3 — CID 97433430
ethyl (Z)-3-[4-[[butyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate (PubChem CID 97433430) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[[butyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[[butyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 97433430 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | ethyl (Z)-3-[4-[[butyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate |
| SMILES | CCCCN(C)C(=O)Nc1ccc(/C=C\C(=O)OCC)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-6-13-19(3)17(21)18-15-10-7-14(8-11-15)9-12-16(20)22-5-2/h7-12H,4-6,13H2,1-3H3,(H,18,21)/b12-9- |
| InChIKey | HEYMJWWXUFUGLU-XFXZXTDPSA-N |
| XLogP | 3.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|