C22H24N2O5 — CID 97433387
ethyl (Z)-3-[4-[[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate (PubChem CID 97433387) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 97433387 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl (Z)-3-[4-[[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)carbamoyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\c1ccc(NC(=O)N(C)Cc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-3-27-21(25)11-7-16-4-8-18(9-5-16)23-22(26)24(2)15-17-6-10-19-20(14-17)29-13-12-28-19/h4-11,14H,3,12-13,15H2,1-2H3,(H,23,26)/b11-7- |
| InChIKey | SIQKPIHNXDOIII-XFFZJAGNSA-N |
| XLogP | 3.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|