C16H15BrFNOS — CID 51292110
N-[(5-bromothiophen-2-yl)methyl]-2-(4-fluorophenyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 51292110) has the molecular formula C16H15BrFNOS and a molecular weight of 368.27 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(4-fluorophenyl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(4-fluorophenyl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51292110 |
| Molecular Formula | C16H15BrFNOS |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(4-fluorophenyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)C1CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15BrFNOS/c1-19(9-12-6-7-15(17)21-12)16(20)14-8-13(14)10-2-4-11(18)5-3-10/h2-7,13-14H,8-9H2,1H3 |
| InChIKey | ZPEKCCUWWVVBOL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |