C16H19BrN2O3S — CID 55360497
N-[(5-bromothiophen-2-yl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide (PubChem CID 55360497) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 55360497 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C16H19BrN2O3S/c1-18(8-10-6-7-13(17)23-10)14(20)9-19-15(21)11-4-2-3-5-12(11)16(19)22/h6-7,11-12H,2-5,8-9H2,1H3 |
| InChIKey | LGJYQETZAGJGLV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|