C23H26N2O3 — CID 51292807
2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(4-ethoxyphenyl)ethyl]acetamide (PubChem CID 51292807) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(4-ethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(4-ethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 51292807 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[1-(4-ethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(C(C)NC(=O)CC2c3ccccc3C=CN2C(C)=O)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-4-28-20-11-9-18(10-12-20)16(2)24-23(27)15-22-21-8-6-5-7-19(21)13-14-25(22)17(3)26/h5-14,16,22H,4,15H2,1-3H3,(H,24,27) |
| InChIKey | KJSNPTXVUWQEAE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |