C20H19N3O4 — CID 18109177
N'-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-2-hydroxybenzohydrazide (PubChem CID 18109177) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N'-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 18109177 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N'-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-2-hydroxybenzohydrazide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H19N3O4/c1-13(24)23-11-10-14-6-2-3-7-15(14)17(23)12-19(26)21-22-20(27)16-8-4-5-9-18(16)25/h2-11,17,25H,12H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | FXLDCFVDBQHIQT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|