C11H15Cl2N3OS — CID 51298157
2,2-dichloro-1-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 51298157) has the molecular formula C11H15Cl2N3OS and a molecular weight of 308.23 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51298157 |
| Molecular Formula | C11H15Cl2N3OS |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)Cc1nnc(NC(=O)C2(C)CC2(Cl)Cl)s1 |
| InChI | InChI=1S/C11H15Cl2N3OS/c1-6(2)4-7-15-16-9(18-7)14-8(17)10(3)5-11(10,12)13/h6H,4-5H2,1-3H3,(H,14,16,17) |
| InChIKey | SYSNXOONJUWUSJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|