C19H17NO4S — CID 51307345
4-acetyl-N-(furan-2-ylmethyl)-N-phenylbenzenesulfonamide (PubChem CID 51307345) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-acetyl-N-(furan-2-ylmethyl)-N-phenylbenzenesulfonamide.
| Compound Name | 4-acetyl-N-(furan-2-ylmethyl)-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 51307345 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-acetyl-N-(furan-2-ylmethyl)-N-phenylbenzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(Cc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-15(21)16-9-11-19(12-10-16)25(22,23)20(14-18-8-5-13-24-18)17-6-3-2-4-7-17/h2-13H,14H2,1H3 |
| InChIKey | VWHLVCBAPYPOFH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |