C16H19ClN2O2S2 — CID 51314164
3-acetamido-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-thiophen-2-ylpropanamide (PubChem CID 51314164) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 3-acetamido-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-thiophen-2-ylpropanamide.
| Compound Name | 3-acetamido-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 51314164 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3-acetamido-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3-thiophen-2-ylpropanamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)CC(NC(C)=O)c1cccs1 |
| InChI | InChI=1S/C16H19ClN2O2S2/c1-3-19(10-12-6-7-15(17)23-12)16(21)9-13(18-11(2)20)14-5-4-8-22-14/h4-8,13H,3,9-10H2,1-2H3,(H,18,20) |
| InChIKey | CPJYPKAFOPXSIQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |