C14H17ClN2O3S3 — CID 55909310
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 55909310) has the molecular formula C14H17ClN2O3S3 and a molecular weight of 392.96 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55909310 |
| Molecular Formula | C14H17ClN2O3S3 |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)C(C)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H17ClN2O3S3/c1-3-17(9-11-6-7-12(15)22-11)14(18)10(2)16-23(19,20)13-5-4-8-21-13/h4-8,10,16H,3,9H2,1-2H3 |
| InChIKey | DFNVRCUJNCZJDP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |