C25H30N4O2 — CID 5131615
N'-(3-methylbutan-2-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]butanediamide (PubChem CID 5131615) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N'-(3-methylbutan-2-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]butanediamide.
| Compound Name | N'-(3-methylbutan-2-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]butanediamide |
|---|---|
| PubChem CID | 5131615 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N'-(3-methylbutan-2-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]butanediamide |
| SMILES | Cc1ccc(-n2nc(-c3ccccc3)cc2NC(=O)CCC(=O)NC(C)C(C)C)cc1 |
| InChI | InChI=1S/C25H30N4O2/c1-17(2)19(4)26-24(30)14-15-25(31)27-23-16-22(20-8-6-5-7-9-20)28-29(23)21-12-10-18(3)11-13-21/h5-13,16-17,19H,14-15H2,1-4H3,(H,26,30)(H,27,31) |
| InChIKey | USYFOQBWIZJZHW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |