C26H32N4O2 — CID 4543622
N'-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-N-pentylpentanediamide (PubChem CID 4543622) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N'-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-N-pentylpentanediamide.
| Compound Name | N'-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-N-pentylpentanediamide |
|---|---|
| PubChem CID | 4543622 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N'-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-N-pentylpentanediamide |
| SMILES | CCCCCNC(=O)CCCC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N4O2/c1-3-4-8-18-27-25(31)12-9-13-26(32)28-24-19-23(21-10-6-5-7-11-21)29-30(24)22-16-14-20(2)15-17-22/h5-7,10-11,14-17,19H,3-4,8-9,12-13,18H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | DIYUSTRSNOUOIU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|