C24H29N5O2 — CID 8772360
2-[[2-[[3-(4-butylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl]amino]-N-methylacetamide (PubChem CID 8772360) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[[2-[[3-(4-butylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl]amino]-N-methylacetamide.
| Compound Name | 2-[[2-[[3-(4-butylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 8772360 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[[2-[[3-(4-butylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl]amino]-N-methylacetamide |
| SMILES | CCCCc1ccc(-c2cc(NC(=O)CNCC(=O)NC)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-3-4-8-18-11-13-19(14-12-18)21-15-22(27-24(31)17-26-16-23(30)25-2)29(28-21)20-9-6-5-7-10-20/h5-7,9-15,26H,3-4,8,16-17H2,1-2H3,(H,25,30)(H,27,31) |
| InChIKey | ALIQKQZRYUGIRI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |