C25H24N4O3 — CID 3976771
N'-(1,3-diphenylpyrazol-5-yl)-N-(furan-2-ylmethyl)pentanediamide (PubChem CID 3976771) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N'-(1,3-diphenylpyrazol-5-yl)-N-(furan-2-ylmethyl)pentanediamide.
| Compound Name | N'-(1,3-diphenylpyrazol-5-yl)-N-(furan-2-ylmethyl)pentanediamide |
|---|---|
| PubChem CID | 3976771 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N'-(1,3-diphenylpyrazol-5-yl)-N-(furan-2-ylmethyl)pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1)NCc1ccco1 |
| InChI | InChI=1S/C25H24N4O3/c30-24(26-18-21-13-8-16-32-21)14-7-15-25(31)27-23-17-22(19-9-3-1-4-10-19)28-29(23)20-11-5-2-6-12-20/h1-6,8-13,16-17H,7,14-15,18H2,(H,26,30)(H,27,31) |
| InChIKey | VQUKTGBTWDYOKD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |