C23H25N3O3 — CID 51317259
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(1-phenylcyclopropyl)methyl]acetamide (PubChem CID 51317259) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(1-phenylcyclopropyl)methyl]acetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(1-phenylcyclopropyl)methyl]acetamide |
|---|---|
| PubChem CID | 51317259 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(1-phenylcyclopropyl)methyl]acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)NCC2(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H25N3O3/c1-2-23(18-11-7-4-8-12-18)20(28)26(21(29)25-23)15-19(27)24-16-22(13-14-22)17-9-5-3-6-10-17/h3-12H,2,13-16H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | IOWLUFMEIABUQH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|