C23H31N3O2S — CID 5132852
1-(1,1-diethoxy-3-phenylsulfanylheptan-3-yl)benzotriazole (PubChem CID 5132852) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-(1,1-diethoxy-3-phenylsulfanylheptan-3-yl)benzotriazole.
| Compound Name | 1-(1,1-diethoxy-3-phenylsulfanylheptan-3-yl)benzotriazole |
|---|---|
| PubChem CID | 5132852 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-(1,1-diethoxy-3-phenylsulfanylheptan-3-yl)benzotriazole |
| SMILES | CCCCC(CC(OCC)OCC)(Sc1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C23H31N3O2S/c1-4-7-17-23(18-22(27-5-2)28-6-3,29-19-13-9-8-10-14-19)26-21-16-12-11-15-20(21)24-25-26/h8-16,22H,4-7,17-18H2,1-3H3 |
| InChIKey | ZEDIGSGZHDWYIP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|