C32H34N4O2 — CID 10767901
N-[2-(benzotriazol-1-yl)-4,4-diethoxy-1,2-diphenylbutyl]aniline (PubChem CID 10767901) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is N-[2-(benzotriazol-1-yl)-4,4-diethoxy-1,2-diphenylbutyl]aniline.
| Compound Name | N-[2-(benzotriazol-1-yl)-4,4-diethoxy-1,2-diphenylbutyl]aniline |
|---|---|
| PubChem CID | 10767901 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-[2-(benzotriazol-1-yl)-4,4-diethoxy-1,2-diphenylbutyl]aniline |
| SMILES | CCOC(CC(c1ccccc1)(C(Nc1ccccc1)c1ccccc1)n1nnc2ccccc21)OCC |
| InChI | InChI=1S/C32H34N4O2/c1-3-37-30(38-4-2)24-32(26-18-10-6-11-19-26,36-29-23-15-14-22-28(29)34-35-36)31(25-16-8-5-9-17-25)33-27-20-12-7-13-21-27/h5-23,30-31,33H,3-4,24H2,1-2H3 |
| InChIKey | HFZWLIXZGLUQTN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|