C24H21N3O5 — CID 5134415
3-(1-benzofuran-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(5-methylfuran-2-yl)-5-oxo-2H-pyrrol-4-olate (PubChem CID 5134415) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(5-methylfuran-2-yl)-5-oxo-2H-pyrrol-4-olate.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(5-methylfuran-2-yl)-5-oxo-2H-pyrrol-4-olate |
|---|---|
| PubChem CID | 5134415 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(5-methylfuran-2-yl)-5-oxo-2H-pyrrol-4-olate |
| SMILES | Cc1ccc(C2C(C(=O)c3cc4ccccc4o3)=C([O-])C(=O)N2CCC[n+]2cc[nH]c2)o1 |
| InChI | InChI=1S/C24H21N3O5/c1-15-7-8-18(31-15)21-20(22(28)19-13-16-5-2-3-6-17(16)32-19)23(29)24(30)27(21)11-4-10-26-12-9-25-14-26/h2-3,5-9,12-14,21H,4,10-11H2,1H3,(H,28,29) |
| InChIKey | MXDVJNADKAGWEF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|