C21H17Cl2N3O4 — CID 4005984
2-(2,4-dichlorophenyl)-3-(furan-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-oxo-2H-pyrrol-4-olate (PubChem CID 4005984) has the molecular formula C21H17Cl2N3O4 and a molecular weight of 446.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(furan-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-oxo-2H-pyrrol-4-olate.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(furan-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-oxo-2H-pyrrol-4-olate |
|---|---|
| PubChem CID | 4005984 |
| Molecular Formula | C21H17Cl2N3O4 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(furan-2-carbonyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-oxo-2H-pyrrol-4-olate |
| SMILES | O=C(C1=C([O-])C(=O)N(CCC[n+]2cc[nH]c2)C1c1ccc(Cl)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C21H17Cl2N3O4/c22-13-4-5-14(15(23)11-13)18-17(19(27)16-3-1-10-30-16)20(28)21(29)26(18)8-2-7-25-9-6-24-12-25/h1,3-6,9-12,18H,2,7-8H2,(H,27,28) |
| InChIKey | LSBBXEIMRZGORI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|