C24H21Cl2N3O4 — CID 5110117
(3-chloro-4-methoxyphenyl)-[2-(3-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 5110117) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-[2-(3-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (3-chloro-4-methoxyphenyl)-[2-(3-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 5110117 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-[2-(3-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | COc1ccc(C([O-])=C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-33-19-7-6-16(13-18(19)26)22(30)20-21(15-4-2-5-17(25)12-15)29(24(32)23(20)31)10-3-9-28-11-8-27-14-28/h2,4-8,11-14,21H,3,9-10H2,1H3,(H,30,31) |
| InChIKey | YIKIRXXJYMCCRW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|