C25H24ClN3O5 — CID 5253324
(3-chloro-4-methoxyphenyl)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 5253324) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (3-chloro-4-methoxyphenyl)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 5253324 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | COc1ccc(C([O-])=C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccccc2OC)cc1Cl |
| InChI | InChI=1S/C25H24ClN3O5/c1-33-19-7-4-3-6-17(19)22-21(23(30)16-8-9-20(34-2)18(26)14-16)24(31)25(32)29(22)12-5-11-28-13-10-27-15-28/h3-4,6-10,13-15,22H,5,11-12H2,1-2H3,(H,30,31) |
| InChIKey | GOKKWRLHNDULQG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|