C38H33Br2N3O6 — CID 51346504
dimethyl 1,3-bis[(4-bromophenyl)methyl]-5'-(1-methoxy-1-oxopropan-2-ylidene)-1'-phenylspiro[benzimidazole-2,4'-pyrrole]-2',3'-dicarboxylate (PubChem CID 51346504) has the molecular formula C38H33Br2N3O6 and a molecular weight of 787.51 g/mol. Its IUPAC name is dimethyl 1,3-bis[(4-bromophenyl)methyl]-5'-(1-methoxy-1-oxopropan-2-ylidene)-1'-phenylspiro[benzimidazole-2,4'-pyrrole]-2',3'-dicarboxylate.
| Compound Name | dimethyl 1,3-bis[(4-bromophenyl)methyl]-5'-(1-methoxy-1-oxopropan-2-ylidene)-1'-phenylspiro[benzimidazole-2,4'-pyrrole]-2',3'-dicarboxylate |
|---|---|
| PubChem CID | 51346504 |
| Molecular Formula | C38H33Br2N3O6 |
| Molecular Weight | 787.51 g/mol |
| Exact Mass | 785.07 |
| IUPAC Name | dimethyl 1,3-bis[(4-bromophenyl)methyl]-5'-(1-methoxy-1-oxopropan-2-ylidene)-1'-phenylspiro[benzimidazole-2,4'-pyrrole]-2',3'-dicarboxylate |
| SMILES | COC(=O)C(C)=C1N(c2ccccc2)C(C(=O)OC)=C(C(=O)OC)C12N(Cc1ccc(Br)cc1)c1ccccc1N2Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C38H33Br2N3O6/c1-24(35(44)47-2)34-38(32(36(45)48-3)33(37(46)49-4)43(34)29-10-6-5-7-11-29)41(22-25-14-18-27(39)19-15-25)30-12-8-9-13-31(30)42(38)23-26-16-20-28(40)21-17-26/h5-21H,22-23H2,1-4H3 |
| InChIKey | VOQFMRQDQFMJJV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|