C30H25N3O6S — CID 102320825
dimethyl 1,4-dibenzoyl-7-phenyl-6-sulfanylidene-1,4,7-triazaspiro[4.4]non-8-ene-8,9-dicarboxylate (PubChem CID 102320825) has the molecular formula C30H25N3O6S and a molecular weight of 555.61 g/mol. Its IUPAC name is dimethyl 1,4-dibenzoyl-7-phenyl-6-sulfanylidene-1,4,7-triazaspiro[4.4]non-8-ene-8,9-dicarboxylate.
| Compound Name | dimethyl 1,4-dibenzoyl-7-phenyl-6-sulfanylidene-1,4,7-triazaspiro[4.4]non-8-ene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 102320825 |
| Molecular Formula | C30H25N3O6S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | dimethyl 1,4-dibenzoyl-7-phenyl-6-sulfanylidene-1,4,7-triazaspiro[4.4]non-8-ene-8,9-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=S)N1c1ccccc1)N(C(=O)c1ccccc1)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H25N3O6S/c1-38-27(36)23-24(28(37)39-2)33(22-16-10-5-11-17-22)29(40)30(23)31(25(34)20-12-6-3-7-13-20)18-19-32(30)26(35)21-14-8-4-9-15-21/h3-17H,18-19H2,1-2H3 |
| InChIKey | NHUMQFCZBIUXQH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|