C24H21NO5S — CID 176936613
dimethyl (12E)-4-oxo-5-phenyl-6-sulfanylidene-5-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-2,8-dicarboxylate (PubChem CID 176936613) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is dimethyl (12E)-4-oxo-5-phenyl-6-sulfanylidene-5-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-2,8-dicarboxylate.
| Compound Name | dimethyl (12E)-4-oxo-5-phenyl-6-sulfanylidene-5-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 176936613 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | dimethyl (12E)-4-oxo-5-phenyl-6-sulfanylidene-5-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-2,8-dicarboxylate |
| SMILES | COC(=O)c1c2c(c(C(=O)OC)c3c1C(=O)N(c1ccccc1)C3=S)CC/C=C\CC2 |
| InChI | InChI=1S/C24H21NO5S/c1-29-23(27)17-15-12-8-3-4-9-13-16(15)18(24(28)30-2)20-19(17)21(26)25(22(20)31)14-10-6-5-7-11-14/h3-7,10-11H,8-9,12-13H2,1-2H3/b4-3- |
| InChIKey | HWMVWGBSTNCRMZ-ARJAWSKDSA-N |
| XLogP | 4.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|