C14H18N2O2 — CID 86636978
[(3Z)-3-methoxyimino-2,2-dimethylpyrrolidin-1-yl]-phenylmethanone (PubChem CID 86636978) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(3Z)-3-methoxyimino-2,2-dimethylpyrrolidin-1-yl]-phenylmethanone.
| Compound Name | [(3Z)-3-methoxyimino-2,2-dimethylpyrrolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 86636978 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(3Z)-3-methoxyimino-2,2-dimethylpyrrolidin-1-yl]-phenylmethanone |
| SMILES | CO/N=C1/CCN(C(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-14(2)12(15-18-3)9-10-16(14)13(17)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3/b15-12- |
| InChIKey | PSJHRBICIZKUJN-QINSGFPZSA-N |
| XLogP | 2.31 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|