C19H19F2NO2 — CID 51348011
2-[1-[4-[(3,4-difluorophenyl)methyl]phenyl]pyrrolidin-2-yl]acetic acid (PubChem CID 51348011) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-[1-[4-[(3,4-difluorophenyl)methyl]phenyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-[(3,4-difluorophenyl)methyl]phenyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 51348011 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[1-[4-[(3,4-difluorophenyl)methyl]phenyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1c1ccc(Cc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F2NO2/c20-17-8-5-14(11-18(17)21)10-13-3-6-15(7-4-13)22-9-1-2-16(22)12-19(23)24/h3-8,11,16H,1-2,9-10,12H2,(H,23,24) |
| InChIKey | VCGJBZBTLYDUHI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|