C20H21NO3 — CID 67085733
2-[1-[4-(2-methylbenzoyl)phenyl]pyrrolidin-2-yl]acetic acid (PubChem CID 67085733) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[1-[4-(2-methylbenzoyl)phenyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-(2-methylbenzoyl)phenyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 67085733 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[1-[4-(2-methylbenzoyl)phenyl]pyrrolidin-2-yl]acetic acid |
| SMILES | Cc1ccccc1C(=O)c1ccc(N2CCCC2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-14-5-2-3-7-18(14)20(24)15-8-10-16(11-9-15)21-12-4-6-17(21)13-19(22)23/h2-3,5,7-11,17H,4,6,12-13H2,1H3,(H,22,23) |
| InChIKey | MSLNMZLFQLWPSI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |