C38H51N3O4 — CID 51348747
N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 51348747) has the molecular formula C38H51N3O4 and a molecular weight of 613.84 g/mol. Its IUPAC name is N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51348747 |
| Molecular Formula | C38H51N3O4 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.39 |
| IUPAC Name | N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNCCNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C38H51N3O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-36(43)40-30-28-39-29-31-41-37(44)34-32-35(42)38(2,45-34)33-25-22-21-23-26-33/h4-5,7-8,10-11,13-14,16-17,19-23,25-26,32,39H,3,6,9,12,15,18,24,27-31H2,1-2H3,(H,40,43)(H,41,44)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | NHQWICBCYJIMOK-JDPCYWKWSA-N |
| XLogP | 6.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|