C26H17FN4O — CID 51350922
1-(4-fluoro-3-methylphenyl)-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 51350922) has the molecular formula C26H17FN4O and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 51350922 |
| Molecular Formula | C26H17FN4O |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | Cc1cc(-n2c(=O)ccc3cnc4ccc(-c5cnc6[nH]ccc6c5)cc4c32)ccc1F |
| InChI | InChI=1S/C26H17FN4O/c1-15-10-20(4-5-22(15)27)31-24(32)7-3-18-13-29-23-6-2-16(12-21(23)25(18)31)19-11-17-8-9-28-26(17)30-14-19/h2-14H,1H3,(H,28,30) |
| InChIKey | UVQOCDJZJCSAEV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|