C19H23N5O3 — CID 51352568
ethyl 6-(2,4-diaminopyrimidin-5-yl)oxy-3-methyl-5-propan-2-yl-1H-indole-2-carboxylate (PubChem CID 51352568) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is ethyl 6-(2,4-diaminopyrimidin-5-yl)oxy-3-methyl-5-propan-2-yl-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-(2,4-diaminopyrimidin-5-yl)oxy-3-methyl-5-propan-2-yl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 51352568 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | ethyl 6-(2,4-diaminopyrimidin-5-yl)oxy-3-methyl-5-propan-2-yl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Oc3cnc(N)nc3N)c(C(C)C)cc2c1C |
| InChI | InChI=1S/C19H23N5O3/c1-5-26-18(25)16-10(4)12-6-11(9(2)3)14(7-13(12)23-16)27-15-8-22-19(21)24-17(15)20/h6-9,23H,5H2,1-4H3,(H4,20,21,22,24) |
| InChIKey | UQPNKQFNOCNPKB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|