C21H18N4O2S — CID 51353320
[4-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]methanesulfonamide (PubChem CID 51353320) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is [4-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]methanesulfonamide.
| Compound Name | [4-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 51353320 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(-c2cn(-c3ccccc3)nc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c22-28(26,27)15-16-6-8-17(9-7-16)20-14-25(19-4-2-1-3-5-19)24-21(20)18-10-12-23-13-11-18/h1-14H,15H2,(H2,22,26,27) |
| InChIKey | XKBNMDPSWGEGQY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |