C27H19FN2O6S — CID 5135432
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-fluorophenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 5135432) has the molecular formula C27H19FN2O6S and a molecular weight of 518.52 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-fluorophenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-fluorophenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5135432 |
| Molecular Formula | C27H19FN2O6S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-fluorophenyl)-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4ccc5c(c4)OCCO5)C3c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C27H19FN2O6S/c1-34-17-7-8-18-21(13-17)37-27(29-18)30-23(14-2-5-16(28)6-3-14)22(25(32)26(30)33)24(31)15-4-9-19-20(12-15)36-11-10-35-19/h2-9,12-13,23,31H,10-11H2,1H3 |
| InChIKey | SYZOCFFMIKXFHN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|