C25H16FN3O5S — CID 6275170
(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-pyridin-4-ylpyrrolidine-2,3-dione (PubChem CID 6275170) has the molecular formula C25H16FN3O5S and a molecular weight of 489.48 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-pyridin-4-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6275170 |
| Molecular Formula | C25H16FN3O5S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(F)cc3s2)C(c2ccncc2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H16FN3O5S/c26-15-2-3-16-19(12-15)35-25(28-16)29-21(13-5-7-27-8-6-13)20(23(31)24(29)32)22(30)14-1-4-17-18(11-14)34-10-9-33-17/h1-8,11-12,21,30H,9-10H2/b22-20+ |
| InChIKey | DVIWNLYITCEDPL-LSDHQDQOSA-N |
| XLogP | 4.23 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|