C33H32BN3O7 — CID 51355948
1-O-benzyl 2-O,4-O-dimethyl (2S,3S,4S,5R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-5-(4-methoxyphenyl)pyrrolidine-1,2,4-tricarboxylate (PubChem CID 51355948) has the molecular formula C33H32BN3O7 and a molecular weight of 593.45 g/mol. Its IUPAC name is 1-O-benzyl 2-O,4-O-dimethyl (2S,3S,4S,5R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-5-(4-methoxyphenyl)pyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O-benzyl 2-O,4-O-dimethyl (2S,3S,4S,5R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-5-(4-methoxyphenyl)pyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 51355948 |
| Molecular Formula | C33H32BN3O7 |
| Molecular Weight | 593.45 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 1-O-benzyl 2-O,4-O-dimethyl (2S,3S,4S,5R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-5-(4-methoxyphenyl)pyrrolidine-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](B2Nc3cccc4cccc(c34)N2)[C@@H](C(=O)OC)N(C(=O)OCc2ccccc2)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H32BN3O7/c1-41-23-17-15-22(16-18-23)29-27(31(38)42-2)28(34-35-24-13-7-11-21-12-8-14-25(36-34)26(21)24)30(32(39)43-3)37(29)33(40)44-19-20-9-5-4-6-10-20/h4-18,27-30,35-36H,19H2,1-3H3/t27-,28-,29-,30-/m0/s1 |
| InChIKey | XTSQNUZUOMMGAN-KRCBVYEFSA-N |
| XLogP | 5.27 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|