C12H8Br2ClNOS — CID 51355981
1-[2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 51355981) has the molecular formula C12H8Br2ClNOS and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 51355981 |
| Molecular Formula | C12H8Br2ClNOS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 406.84 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br |
| InChI | InChI=1S/C12H8Br2ClNOS/c1-6(17)10-9(11(13)14)16-12(18-10)7-2-4-8(15)5-3-7/h2-5,11H,1H3 |
| InChIKey | JGISAVGHVQNRPK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|