About 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone
1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone (PubChem CID 540397) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone |
| PubChem CID | 540397 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C12H11NOS/c1-8-11(9(2)14)15-12(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | RXSKZUOBXJWMHY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone (CID 540397) is 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone is CC(=O)c1sc(-c2ccccc2)nc1C.
What is the InChIKey of 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone?
The InChIKey is RXSKZUOBXJWMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c1-8-11(9(2)14)15-12(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone?
1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone has a molecular weight of 217.29 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 540397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).