C18H16FNOS — CID 51356497
(4-fluorocyclohexyl)-[2-(2-phenylethynyl)-1,3-thiazol-5-yl]methanone (PubChem CID 51356497) has the molecular formula C18H16FNOS and a molecular weight of 313.40 g/mol. Its IUPAC name is (4-fluorocyclohexyl)-[2-(2-phenylethynyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | (4-fluorocyclohexyl)-[2-(2-phenylethynyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 51356497 |
| Molecular Formula | C18H16FNOS |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (4-fluorocyclohexyl)-[2-(2-phenylethynyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C#Cc2ccccc2)s1)C1CCC(F)CC1 |
| InChI | InChI=1S/C18H16FNOS/c19-15-9-7-14(8-10-15)18(21)16-12-20-17(22-16)11-6-13-4-2-1-3-5-13/h1-5,12,14-15H,7-10H2 |
| InChIKey | LSSUIPDNPSQICF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|