C20H17NO4 — CID 51356642
2-(tert-butylamino)-3-(furan-3-yl)benzo[f][1]benzofuran-4,9-dione (PubChem CID 51356642) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-(tert-butylamino)-3-(furan-3-yl)benzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-(tert-butylamino)-3-(furan-3-yl)benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 51356642 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(tert-butylamino)-3-(furan-3-yl)benzo[f][1]benzofuran-4,9-dione |
| SMILES | CC(C)(C)Nc1oc2c(c1-c1ccoc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H17NO4/c1-20(2,3)21-19-14(11-8-9-24-10-11)15-16(22)12-6-4-5-7-13(12)17(23)18(15)25-19/h4-10,21H,1-3H3 |
| InChIKey | HVMNEDRVWNWIMF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|