C18H27NO2S — CID 51357490
(R)-N-[(3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-yl]-4-methylbenzenesulfinamide (PubChem CID 51357490) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is (R)-N-[(3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-yl]-4-methylbenzenesulfinamide.
| Compound Name | (R)-N-[(3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-yl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 51357490 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (R)-N-[(3S,4E)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-yl]-4-methylbenzenesulfinamide |
| SMILES | C=C/C=C(/OCC)[C@@H](N[S@](=O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H27NO2S/c1-7-9-16(21-8-2)17(18(4,5)6)19-22(20)15-12-10-14(3)11-13-15/h7,9-13,17,19H,1,8H2,2-6H3/b16-9+/t17-,22-/m1/s1 |
| InChIKey | FFANKTKPBCOFGR-QWIVHCALSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|